C10H14O3 — CID 46174002
(1S,2S,4S,5S,7R)-5-hydroxy-5,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-6-one (PubChem CID 46174002) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1S,2S,4S,5S,7R)-5-hydroxy-5,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-6-one.
| Compound Name | (1S,2S,4S,5S,7R)-5-hydroxy-5,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-6-one |
|---|---|
| PubChem CID | 46174002 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1S,2S,4S,5S,7R)-5-hydroxy-5,8,8-trimethyl-3-oxatricyclo[5.1.0.02,4]octan-6-one |
| SMILES | CC1(C)[C@H]2[C@@H]3O[C@@H]3[C@](C)(O)C(=O)[C@H]21 |
| InChI | InChI=1S/C10H14O3/c1-9(2)4-5(9)7(11)10(3,12)8-6(4)13-8/h4-6,8,12H,1-3H3/t4-,5+,6+,8+,10-/m1/s1 |
| InChIKey | SCGLOUANVXWSOO-OKTXDSFISA-N |
| XLogP | 0.36 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|