About sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione
sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione (PubChem CID 46174103) has the molecular formula C19H19N2NaO2
and a molecular weight of 330.36 g/mol. Its IUPAC name is sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione.
Molecular Properties
| Compound Name | sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione |
| PubChem CID | 46174103 |
| Molecular Formula | C19H19N2NaO2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione |
| SMILES | CCCC[c-]1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O.[Na+] |
| InChI | InChI=1S/C19H19N2O2.Na/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;/h4-13H,2-3,14H2,1H3;/q-1;+1 |
| InChIKey | VYOUHDLOIRJOSW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione?
The IUPAC name of sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione (CID 46174103) is sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione.
What is the SMILES notation for sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione?
The canonical SMILES for sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione is CCCC[c-]1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O.[Na+].
What is the InChIKey of sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione?
The InChIKey is VYOUHDLOIRJOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N2O2.Na/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;/h4-13H,2-3,14H2,1H3;/q-1;+1.
What are the key properties of sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione?
sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione has a molecular weight of 330.36 g/mol, XLogP of 0.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-butyl-1,2-diphenylpyrazolidin-4-ide-3,5-dione is sourced from PubChem (CID 46174103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).