C18H34I2N6 — CID 46175171
4-methyl-1-[12-(4-methyl-1,2,4-triazol-4-ium-1-yl)dodecyl]-1,2,4-triazol-4-ium diiodide (PubChem CID 46175171) has the molecular formula C18H34I2N6 and a molecular weight of 588.32 g/mol. Its IUPAC name is 4-methyl-1-[12-(4-methyl-1,2,4-triazol-4-ium-1-yl)dodecyl]-1,2,4-triazol-4-ium diiodide.
| Compound Name | 4-methyl-1-[12-(4-methyl-1,2,4-triazol-4-ium-1-yl)dodecyl]-1,2,4-triazol-4-ium diiodide |
|---|---|
| PubChem CID | 46175171 |
| Molecular Formula | C18H34I2N6 |
| Molecular Weight | 588.32 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 4-methyl-1-[12-(4-methyl-1,2,4-triazol-4-ium-1-yl)dodecyl]-1,2,4-triazol-4-ium diiodide |
| SMILES | C[n+]1cnn(CCCCCCCCCCCCn2c[n+](C)cn2)c1.[I-].[I-] |
| InChI | InChI=1S/C18H34N6.2HI/c1-21-15-19-23(17-21)13-11-9-7-5-3-4-6-8-10-12-14-24-18-22(2)16-20-24;;/h15-18H,3-14H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | CKXMRXOIAYMKFK-UHFFFAOYSA-L |
| XLogP | -3.66 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.32 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|