C19H22ClN5O5 — CID 46175314
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5-methoxy-7-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46175314) has the molecular formula C19H22ClN5O5 and a molecular weight of 435.87 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5-methoxy-7-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5-methoxy-7-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46175314 |
| Molecular Formula | C19H22ClN5O5 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(5-methoxy-7-methylfuro[2,3-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | COc1cc2cc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)oc2c(C)n1 |
| InChI | InChI=1S/C19H22ClN5O5/c1-7-16-8(5-12(22-7)29-2)4-11(30-16)13-17(20)24-19(21)25-18(13)23-10-3-9(6-26)14(27)15(10)28/h4-5,9-10,14-15,26-28H,3,6H2,1-2H3,(H3,21,23,24,25)/t9-,10-,14-,15+/m1/s1 |
| InChIKey | GMNAUYQLKGRBOC-IDMWTJEOSA-N |
| XLogP | 1.35 |
| TPSA | 159.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |