C51H89N3O17 — CID 46175350
4-[1,3-bis[2,3-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]propoxy]propan-2-yloxymethyl]-1-[1,3-bis(hex-5-enoxy)propan-2-yl]triazole (PubChem CID 46175350) has the molecular formula C51H89N3O17 and a molecular weight of 1016.28 g/mol. Its IUPAC name is 4-[1,3-bis[2,3-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]propoxy]propan-2-yloxymethyl]-1-[1,3-bis(hex-5-enoxy)propan-2-yl]triazole.
| Compound Name | 4-[1,3-bis[2,3-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]propoxy]propan-2-yloxymethyl]-1-[1,3-bis(hex-5-enoxy)propan-2-yl]triazole |
|---|---|
| PubChem CID | 46175350 |
| Molecular Formula | C51H89N3O17 |
| Molecular Weight | 1016.28 g/mol |
| Exact Mass | 1015.62 |
| IUPAC Name | 4-[1,3-bis[2,3-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]propoxy]propan-2-yloxymethyl]-1-[1,3-bis(hex-5-enoxy)propan-2-yl]triazole |
| SMILES | C=CCCCCOCC(COCCCCC=C)n1cc(COC(COCC(COCC2COC(C)(C)O2)OCC2COC(C)(C)O2)COCC(COCC2COC(C)(C)O2)OCC2COC(C)(C)O2)nn1 |
| InChI | InChI=1S/C51H89N3O17/c1-11-13-15-17-19-55-23-40(24-56-20-18-16-14-12-2)54-21-39(52-53-54)22-61-41(25-57-27-42(62-33-46-37-66-50(7,8)70-46)29-59-31-44-35-64-48(3,4)68-44)26-58-28-43(63-34-47-38-67-51(9,10)71-47)30-60-32-45-36-65-49(5,6)69-45/h11-12,21,40-47H,1-2,13-20,22-38H2,3-10H3 |
| InChIKey | YOUONYIVNSQJKR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 187.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.28 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|