C7H7N3O3S — CID 46175391
N-hydroxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 46175391) has the molecular formula C7H7N3O3S and a molecular weight of 213.22 g/mol. Its IUPAC name is N-hydroxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-hydroxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46175391 |
| Molecular Formula | C7H7N3O3S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | N-hydroxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | O=C(NO)c1cnc2n(c1=O)CCS2 |
| InChI | InChI=1S/C7H7N3O3S/c11-5(9-13)4-3-8-7-10(6(4)12)1-2-14-7/h3,13H,1-2H2,(H,9,11) |
| InChIKey | CLJUTYCAURGAJY-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|