C19H23ClN6O3S — CID 46175485
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46175485) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46175485 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CN(C)c1ccc2nc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)sc2c1 |
| InChI | InChI=1S/C19H23ClN6O3S/c1-26(2)9-3-4-10-12(6-9)30-18(23-10)13-16(20)24-19(21)25-17(13)22-11-5-8(7-27)14(28)15(11)29/h3-4,6,8,11,14-15,27-29H,5,7H2,1-2H3,(H3,21,22,24,25)/t8-,11-,14-,15+/m1/s1 |
| InChIKey | MRQGMNZPDPLLOO-SVYABLODSA-N |
| XLogP | 1.57 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |