C18H20ClN5O4S — CID 46175664
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46175664) has the molecular formula C18H20ClN5O4S and a molecular weight of 437.91 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46175664 |
| Molecular Formula | C18H20ClN5O4S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | COc1ccc2nc(-c3c(Cl)nc(N)nc3N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)sc2c1 |
| InChI | InChI=1S/C18H20ClN5O4S/c1-28-8-2-3-9-11(5-8)29-17(22-9)12-15(19)23-18(20)24-16(12)21-10-4-7(6-25)13(26)14(10)27/h2-3,5,7,10,13-14,25-27H,4,6H2,1H3,(H3,20,21,23,24)/t7-,10-,13-,14+/m1/s1 |
| InChIKey | OMTPUOCOBRCKNS-WOJZAVQGSA-N |
| XLogP | 1.51 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |