C19H21ClN4O5S — CID 46176089
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(2-methylsulfonylphenyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46176089) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(2-methylsulfonylphenyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(2-methylsulfonylphenyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46176089 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-(2-methylsulfonylphenyl)ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CS(=O)(=O)c1ccccc1C#Cc1c(Cl)nc(N)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21ClN4O5S/c1-30(28,29)14-5-3-2-4-10(14)6-7-12-17(20)23-19(21)24-18(12)22-13-8-11(9-25)15(26)16(13)27/h2-5,11,13,15-16,25-27H,8-9H2,1H3,(H3,21,22,23,24)/t11-,13-,15-,16+/m1/s1 |
| InChIKey | PIDKTVIDBWITNI-CUBALJKWSA-N |
| XLogP | 0.03 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|