C21H21ClN6O3S — CID 46176091
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-[2-methyl-6-(1,3-thiazol-2-yl)-3-pyridinyl]ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46176091) has the molecular formula C21H21ClN6O3S and a molecular weight of 472.96 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-[2-methyl-6-(1,3-thiazol-2-yl)-3-pyridinyl]ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-[2-methyl-6-(1,3-thiazol-2-yl)-3-pyridinyl]ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46176091 |
| Molecular Formula | C21H21ClN6O3S |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-[2-[2-methyl-6-(1,3-thiazol-2-yl)-3-pyridinyl]ethynyl]pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(-c2nccs2)ccc1C#Cc1c(Cl)nc(N)nc1N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H21ClN6O3S/c1-10-11(3-5-14(25-10)20-24-6-7-32-20)2-4-13-18(22)27-21(23)28-19(13)26-15-8-12(9-29)16(30)17(15)31/h3,5-7,12,15-17,29-31H,8-9H2,1H3,(H3,23,26,27,28)/t12-,15-,16-,17+/m1/s1 |
| InChIKey | SRUBSEDYZWJWKM-YYQUZTFQSA-N |
| XLogP | 1.45 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|