C20H22F3N5O4 — CID 46176099
(1R,2S,3R,5R)-3-[[5-(1,3-benzoxazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46176099) has the molecular formula C20H22F3N5O4 and a molecular weight of 453.42 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1,3-benzoxazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzoxazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46176099 |
| Molecular Formula | C20H22F3N5O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzoxazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H22F3N5O4/c1-9-14(18-27-11-4-2-3-5-13(11)32-18)17(28-19(25-9)24-8-20(21,22)23)26-12-6-10(7-29)15(30)16(12)31/h2-5,10,12,15-16,29-31H,6-8H2,1H3,(H2,24,25,26,28)/t10-,12-,15-,16+/m1/s1 |
| InChIKey | VISWSKDDHYAJPK-NODPJGRNSA-N |
| XLogP | 2.08 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |