C43H46N2O4 — CID 46176314
bis[(6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] pentanedioate (PubChem CID 46176314) has the molecular formula C43H46N2O4 and a molecular weight of 654.85 g/mol. Its IUPAC name is bis[(6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] pentanedioate.
| Compound Name | bis[(6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] pentanedioate |
|---|---|
| PubChem CID | 46176314 |
| Molecular Formula | C43H46N2O4 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | bis[(6aR)-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] pentanedioate |
| SMILES | CCCN1CCc2cccc3c2[C@H]1Cc1cccc(OC(=O)CCCC(=O)Oc2cccc4c2-c2cccc5c2[C@@H](C4)N(CCC)CC5)c1-3 |
| InChI | InChI=1S/C43H46N2O4/c1-3-22-44-24-20-28-10-5-14-32-40(28)34(44)26-30-12-7-16-36(42(30)32)48-38(46)18-9-19-39(47)49-37-17-8-13-31-27-35-41-29(21-25-45(35)23-4-2)11-6-15-33(41)43(31)37/h5-8,10-17,34-35H,3-4,9,18-27H2,1-2H3/t34-,35-/m1/s1 |
| InChIKey | KUMPVIZGFOOGCF-VSJLXWSYSA-N |
| XLogP | 8.43 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|