C24H26N4O3S2 — CID 46176447
(1R,2S,3R,5R)-3-[[5-(1-benzothiophen-2-yl)-6-methyl-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46176447) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1-benzothiophen-2-yl)-6-methyl-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1-benzothiophen-2-yl)-6-methyl-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46176447 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1-benzothiophen-2-yl)-6-methyl-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2cccs2)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H26N4O3S2/c1-13-20(19-10-14-5-2-3-7-18(14)33-19)23(27-17-9-15(12-29)21(30)22(17)31)28-24(26-13)25-11-16-6-4-8-32-16/h2-8,10,15,17,21-22,29-31H,9,11-12H2,1H3,(H2,25,26,27,28)/t15-,17-,21-,22+/m1/s1 |
| InChIKey | UONHAWSTKILUKN-VIDZHXABSA-N |
| XLogP | 3.85 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |