C26H39F3N6O7S — CID 46176490
N-[[5-[4-[4-(dimethylamino)butyl]piperazine-1-carbonyl]-1,2,4-oxadiazol-3-yl]methyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 46176490) has the molecular formula C26H39F3N6O7S and a molecular weight of 636.69 g/mol. Its IUPAC name is N-[[5-[4-[4-(dimethylamino)butyl]piperazine-1-carbonyl]-1,2,4-oxadiazol-3-yl]methyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[5-[4-[4-(dimethylamino)butyl]piperazine-1-carbonyl]-1,2,4-oxadiazol-3-yl]methyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46176490 |
| Molecular Formula | C26H39F3N6O7S |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | N-[[5-[4-[4-(dimethylamino)butyl]piperazine-1-carbonyl]-1,2,4-oxadiazol-3-yl]methyl]-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)Cc2noc(C(=O)N3CCN(CCCCN(C)C)CC3)n2)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H38N6O5S.C2HF3O2/c1-18-15-20(34-6)16-19(2)22(18)36(32,33)28(5)17-21-25-23(35-26-21)24(31)30-13-11-29(12-14-30)10-8-7-9-27(3)4;3-2(4,5)1(6)7/h15-16H,7-14,17H2,1-6H3;(H,6,7) |
| InChIKey | OKPCNGSVMKVVFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|