About 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol
3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol (PubChem CID 46177499) has the molecular formula C17H26O2S
and a molecular weight of 294.46 g/mol. Its IUPAC name is 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol.
Molecular Properties
| Compound Name | 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol |
| PubChem CID | 46177499 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol |
| SMILES | COc1cccc(C2SCC(C)(C)C2(O)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O2S/c1-15(2,3)17(18)14(20-11-16(17,4)5)12-8-7-9-13(10-12)19-6/h7-10,14,18H,11H2,1-6H3 |
| InChIKey | MWQJUEIQBAVGCN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol?
The IUPAC name of 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol (CID 46177499) is 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol.
What is the SMILES notation for 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol?
The canonical SMILES for 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol is COc1cccc(C2SCC(C)(C)C2(O)C(C)(C)C)c1.
What is the InChIKey of 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol?
The InChIKey is MWQJUEIQBAVGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2S/c1-15(2,3)17(18)14(20-11-16(17,4)5)12-8-7-9-13(10-12)19-6/h7-10,14,18H,11H2,1-6H3.
What are the key properties of 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol?
3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol has a molecular weight of 294.46 g/mol, XLogP of 4.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-(3-methoxyphenyl)-4,4-dimethylthiolan-3-ol is sourced from PubChem (CID 46177499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).