About (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate (PubChem CID 46177548) has the molecular formula C25H23NO2S3
and a molecular weight of 465.67 g/mol. Its IUPAC name is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate.
Molecular Properties
| Compound Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate |
| PubChem CID | 46177548 |
| Molecular Formula | C25H23NO2S3 |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate |
| SMILES | CCCNC(=S)SC(CC(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccccc1 |
| InChI | InChI=1S/C25H23NO2S3/c1-2-14-26-25(29)31-23(17-8-4-3-5-9-17)16-19(27)18-12-13-21-24(15-18)30-22-11-7-6-10-20(22)28-21/h3-13,15,23H,2,14,16H2,1H3,(H,26,29) |
| InChIKey | RYCVTTKQUQLWLJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate?
The IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate (CID 46177548) is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate.
What is the SMILES notation for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate?
The canonical SMILES for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate is CCCNC(=S)SC(CC(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccccc1.
What is the InChIKey of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate?
The InChIKey is RYCVTTKQUQLWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO2S3/c1-2-14-26-25(29)31-23(17-8-4-3-5-9-17)16-19(27)18-12-13-21-24(15-18)30-22-11-7-6-10-20(22)28-21/h3-13,15,23H,2,14,16H2,1H3,(H,26,29).
What are the key properties of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate?
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate has a molecular weight of 465.67 g/mol, XLogP of 7.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-propylcarbamodithioate is sourced from PubChem (CID 46177548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).