About (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate (PubChem CID 46177630) has the molecular formula C28H29NO4S3
and a molecular weight of 539.74 g/mol. Its IUPAC name is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate.
Molecular Properties
| Compound Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate |
| PubChem CID | 46177630 |
| Molecular Formula | C28H29NO4S3 |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate |
| SMILES | CCOC(CNC(=S)SC(CC(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccccc1)OCC |
| InChI | InChI=1S/C28H29NO4S3/c1-3-31-27(32-4-2)18-29-28(34)36-25(19-10-6-5-7-11-19)17-21(30)20-14-15-23-26(16-20)35-24-13-9-8-12-22(24)33-23/h5-16,25,27H,3-4,17-18H2,1-2H3,(H,29,34) |
| InChIKey | YSDSXGHJUBBODD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate?
The IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate (CID 46177630) is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate.
What is the SMILES notation for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate?
The canonical SMILES for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate is CCOC(CNC(=S)SC(CC(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccccc1)OCC.
What is the InChIKey of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate?
The InChIKey is YSDSXGHJUBBODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO4S3/c1-3-31-27(32-4-2)18-29-28(34)36-25(19-10-6-5-7-11-19)17-21(30)20-14-15-23-26(16-20)35-24-13-9-8-12-22(24)33-23/h5-16,25,27H,3-4,17-18H2,1-2H3,(H,29,34).
What are the key properties of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate?
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate has a molecular weight of 539.74 g/mol, XLogP of 7.26, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-(2,2-diethoxyethyl)carbamodithioate is sourced from PubChem (CID 46177630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).