About (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate (PubChem CID 46177631) has the molecular formula C29H23NO2S3
and a molecular weight of 513.71 g/mol. Its IUPAC name is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate.
Molecular Properties
| Compound Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate |
| PubChem CID | 46177631 |
| Molecular Formula | C29H23NO2S3 |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate |
| SMILES | O=C(CC(SC(=S)NCc1ccccc1)c1ccccc1)c1ccc2c(c1)Sc1ccccc1O2 |
| InChI | InChI=1S/C29H23NO2S3/c31-23(22-15-16-25-28(17-22)34-26-14-8-7-13-24(26)32-25)18-27(21-11-5-2-6-12-21)35-29(33)30-19-20-9-3-1-4-10-20/h1-17,27H,18-19H2,(H,30,33) |
| InChIKey | DPXPOALAGFDAMO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate?
The IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate (CID 46177631) is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate.
What is the SMILES notation for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate?
The canonical SMILES for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate is O=C(CC(SC(=S)NCc1ccccc1)c1ccccc1)c1ccc2c(c1)Sc1ccccc1O2.
What is the InChIKey of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate?
The InChIKey is DPXPOALAGFDAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23NO2S3/c31-23(22-15-16-25-28(17-22)34-26-14-8-7-13-24(26)32-25)18-27(21-11-5-2-6-12-21)35-29(33)30-19-20-9-3-1-4-10-20/h1-17,27H,18-19H2,(H,30,33).
What are the key properties of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate?
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate has a molecular weight of 513.71 g/mol, XLogP of 8.07, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-benzylcarbamodithioate is sourced from PubChem (CID 46177631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).