About (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate (PubChem CID 46177632) has the molecular formula C28H21NO2S3
and a molecular weight of 499.68 g/mol. Its IUPAC name is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate |
| PubChem CID | 46177632 |
| Molecular Formula | C28H21NO2S3 |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate |
| SMILES | O=C(CC(SC(=S)Nc1ccccc1)c1ccccc1)c1ccc2c(c1)Sc1ccccc1O2 |
| InChI | InChI=1S/C28H21NO2S3/c30-22(20-15-16-24-27(17-20)33-25-14-8-7-13-23(25)31-24)18-26(19-9-3-1-4-10-19)34-28(32)29-21-11-5-2-6-12-21/h1-17,26H,18H2,(H,29,32) |
| InChIKey | AYBDYFPFMTXNNV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate?
The IUPAC name of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate (CID 46177632) is (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate.
What is the SMILES notation for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate?
The canonical SMILES for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate is O=C(CC(SC(=S)Nc1ccccc1)c1ccccc1)c1ccc2c(c1)Sc1ccccc1O2.
What is the InChIKey of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate?
The InChIKey is AYBDYFPFMTXNNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H21NO2S3/c30-22(20-15-16-24-27(17-20)33-25-14-8-7-13-23(25)31-24)18-26(19-9-3-1-4-10-19)34-28(32)29-21-11-5-2-6-12-21/h1-17,26H,18H2,(H,29,32).
What are the key properties of (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate?
(3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate has a molecular weight of 499.68 g/mol, XLogP of 8.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-3-phenoxathiin-2-yl-1-phenylpropyl) N-phenylcarbamodithioate is sourced from PubChem (CID 46177632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).