About 1-ethenyl-1-methyl-2,3-dihydropyrrolizine
1-ethenyl-1-methyl-2,3-dihydropyrrolizine (PubChem CID 46177866) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-ethenyl-1-methyl-2,3-dihydropyrrolizine.
Molecular Properties
| Compound Name | 1-ethenyl-1-methyl-2,3-dihydropyrrolizine |
| PubChem CID | 46177866 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-ethenyl-1-methyl-2,3-dihydropyrrolizine |
| SMILES | C=CC1(C)CCn2cccc21 |
| InChI | InChI=1S/C10H13N/c1-3-10(2)6-8-11-7-4-5-9(10)11/h3-5,7H,1,6,8H2,2H3 |
| InChIKey | PTOMSWRRWXEJOW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1-methyl-2,3-dihydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1-methyl-2,3-dihydropyrrolizine?
The IUPAC name of 1-ethenyl-1-methyl-2,3-dihydropyrrolizine (CID 46177866) is 1-ethenyl-1-methyl-2,3-dihydropyrrolizine.
What is the SMILES notation for 1-ethenyl-1-methyl-2,3-dihydropyrrolizine?
The canonical SMILES for 1-ethenyl-1-methyl-2,3-dihydropyrrolizine is C=CC1(C)CCn2cccc21.
What is the InChIKey of 1-ethenyl-1-methyl-2,3-dihydropyrrolizine?
The InChIKey is PTOMSWRRWXEJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-3-10(2)6-8-11-7-4-5-9(10)11/h3-5,7H,1,6,8H2,2H3.
What are the key properties of 1-ethenyl-1-methyl-2,3-dihydropyrrolizine?
1-ethenyl-1-methyl-2,3-dihydropyrrolizine has a molecular weight of 147.22 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1-methyl-2,3-dihydropyrrolizine is sourced from PubChem (CID 46177866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).