C20H17Cl4N — CID 46177886
(1R,2S,10S,11R,12S)-5,7-dichloro-10-(3,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene (PubChem CID 46177886) has the molecular formula C20H17Cl4N and a molecular weight of 413.18 g/mol. Its IUPAC name is (1R,2S,10S,11R,12S)-5,7-dichloro-10-(3,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene.
| Compound Name | (1R,2S,10S,11R,12S)-5,7-dichloro-10-(3,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 46177886 |
| Molecular Formula | C20H17Cl4N |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | (1R,2S,10S,11R,12S)-5,7-dichloro-10-(3,4-dichlorophenyl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene |
| SMILES | Clc1cc(Cl)c2c(c1)[C@H]1[C@@H]3CC[C@@H](C3)[C@H]1[C@@H](c1ccc(Cl)c(Cl)c1)N2 |
| InChI | InChI=1S/C20H17Cl4N/c21-12-7-13-17-9-1-2-10(5-9)18(17)19(25-20(13)16(24)8-12)11-3-4-14(22)15(23)6-11/h3-4,6-10,17-19,25H,1-2,5H2/t9-,10+,17-,18-,19-/m1/s1 |
| InChIKey | HJCZNTYGBHDNTL-JKYZOAGZSA-N |
| XLogP | 7.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |