About (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide
(R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 46177993) has the molecular formula C15H29NOS
and a molecular weight of 271.47 g/mol. Its IUPAC name is (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 46177993 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CCCCC#C[C@H](N[S@](=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29NOS/c1-8-9-10-11-12-13(14(2,3)4)16-18(17)15(5,6)7/h13,16H,8-10H2,1-7H3/t13-,18+/m0/s1 |
| InChIKey | NOZPPKGWHNOAEN-SCLBCKFNSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide (CID 46177993) is (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide is CCCCC#C[C@H](N[S@](=O)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is NOZPPKGWHNOAEN-SCLBCKFNSA-N. The full InChI is InChI=1S/C15H29NOS/c1-8-9-10-11-12-13(14(2,3)4)16-18(17)15(5,6)7/h13,16H,8-10H2,1-7H3/t13-,18+/m0/s1.
What are the key properties of (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide?
(R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 271.47 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(3R)-2,2-dimethylnon-4-yn-3-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 46177993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).