C20H32O3 — CID 46178053
(1R,3aS,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,3a,4,7,8-hexahydroazulene-3,2'-1,3-dioxolane]-5-one (PubChem CID 46178053) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,3aS,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,3a,4,7,8-hexahydroazulene-3,2'-1,3-dioxolane]-5-one.
| Compound Name | (1R,3aS,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,3a,4,7,8-hexahydroazulene-3,2'-1,3-dioxolane]-5-one |
|---|---|
| PubChem CID | 46178053 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,3aS,6S,8aR)-6,8a-dimethyl-1-propan-2-yl-6-prop-2-enylspiro[1,2,3a,4,7,8-hexahydroazulene-3,2'-1,3-dioxolane]-5-one |
| SMILES | C=CC[C@]1(C)CC[C@]2(C)[C@@H](C(C)C)CC3(OCCO3)[C@H]2CC1=O |
| InChI | InChI=1S/C20H32O3/c1-6-7-18(4)8-9-19(5)15(14(2)3)13-20(22-10-11-23-20)16(19)12-17(18)21/h6,14-16H,1,7-13H2,2-5H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | DTESPPXFYJLDTM-UKBAYJJMSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|