C28H39NO4Si — CID 46178062
[(1S,2S,4R,7R,8R,9R)-8,9-bis(phenylmethoxy)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 46178062) has the molecular formula C28H39NO4Si and a molecular weight of 481.71 g/mol. Its IUPAC name is [(1S,2S,4R,7R,8R,9R)-8,9-bis(phenylmethoxy)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,4R,7R,8R,9R)-8,9-bis(phenylmethoxy)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46178062 |
| Molecular Formula | C28H39NO4Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [(1S,2S,4R,7R,8R,9R)-8,9-bis(phenylmethoxy)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]2[C@@H]3O[C@@H]3CN21 |
| InChI | InChI=1S/C28H39NO4Si/c1-28(2,3)34(4,5)32-19-22-25(30-17-20-12-8-6-9-13-20)27(24-26-23(33-26)16-29(22)24)31-18-21-14-10-7-11-15-21/h6-15,22-27H,16-19H2,1-5H3/t22-,23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | AECOZPQARFCHJO-ZRRJEQDASA-N |
| XLogP | 5.01 |
| TPSA | 43.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|