C26H19F12NO3S — CID 46178132
[2-tert-butyl-4,5-diphenyl-6-(trifluoromethyl)-3-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 46178132) has the molecular formula C26H19F12NO3S and a molecular weight of 653.49 g/mol. Its IUPAC name is [2-tert-butyl-4,5-diphenyl-6-(trifluoromethyl)-3-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [2-tert-butyl-4,5-diphenyl-6-(trifluoromethyl)-3-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 46178132 |
| Molecular Formula | C26H19F12NO3S |
| Molecular Weight | 653.49 g/mol |
| Exact Mass | 653.09 |
| IUPAC Name | [2-tert-butyl-4,5-diphenyl-6-(trifluoromethyl)-3-pyridinyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)c1nc(C(F)(F)F)c(-c2ccccc2)c(-c2ccccc2)c1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H19F12NO3S/c1-21(2,3)20-18(42-43(40,41)26(37,38)24(32,33)23(30,31)25(34,35)36)16(14-10-6-4-7-11-14)17(15-12-8-5-9-13-15)19(39-20)22(27,28)29/h4-13H,1-3H3 |
| InChIKey | SEWVYHLXLIUUPD-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.49 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|