C22H24O8 — CID 46178176
(2R,5R,6R,9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-11,13-dimethoxy-3,8-dioxatetracyclo[8.4.0.02,6.05,9]tetradeca-1(14),10,12-trien-12-ol (PubChem CID 46178176) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is (2R,5R,6R,9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-11,13-dimethoxy-3,8-dioxatetracyclo[8.4.0.02,6.05,9]tetradeca-1(14),10,12-trien-12-ol.
| Compound Name | (2R,5R,6R,9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-11,13-dimethoxy-3,8-dioxatetracyclo[8.4.0.02,6.05,9]tetradeca-1(14),10,12-trien-12-ol |
|---|---|
| PubChem CID | 46178176 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (2R,5R,6R,9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-11,13-dimethoxy-3,8-dioxatetracyclo[8.4.0.02,6.05,9]tetradeca-1(14),10,12-trien-12-ol |
| SMILES | COc1cc([C@@]23OC[C@@H]4[C@@H](OC[C@@H]42)c2cc(OC)c(O)c(OC)c23)cc(OC)c1O |
| InChI | InChI=1S/C22H24O8/c1-25-14-5-10(6-15(26-2)18(14)23)22-13-9-29-20(12(13)8-30-22)11-7-16(27-3)19(24)21(28-4)17(11)22/h5-7,12-13,20,23-24H,8-9H2,1-4H3/t12-,13-,20-,22+/m0/s1 |
| InChIKey | LEUPVRQBQXLAPY-MZDRQSKRSA-N |
| XLogP | 2.72 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |