About 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine
3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine (PubChem CID 46178745) has the molecular formula C17H18ClN3
and a molecular weight of 299.81 g/mol. Its IUPAC name is 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine |
| PubChem CID | 46178745 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCCC(c1ccccc1)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C17H18ClN3/c1-19-9-7-13(12-5-3-2-4-6-12)14-11-21-17-16(14)15(18)8-10-20-17/h2-6,8,10-11,13,19H,7,9H2,1H3,(H,20,21) |
| InChIKey | GLBHUBLFCATGDF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine?
The IUPAC name of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine (CID 46178745) is 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine.
What is the SMILES notation for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine?
The canonical SMILES for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine is CNCCC(c1ccccc1)c1c[nH]c2nccc(Cl)c12.
What is the InChIKey of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine?
The InChIKey is GLBHUBLFCATGDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3/c1-19-9-7-13(12-5-3-2-4-6-12)14-11-21-17-16(14)15(18)8-10-20-17/h2-6,8,10-11,13,19H,7,9H2,1H3,(H,20,21).
What are the key properties of 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine?
3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine has a molecular weight of 299.81 g/mol, XLogP of 3.96, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N-methyl-3-phenylpropan-1-amine is sourced from PubChem (CID 46178745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).