C20H27Cl2N3O2 — CID 46179311
(E,3R,4R)-8-(2,3-dichlorophenoxy)-2,2,6,7-tetramethyl-4-(1,2,4-triazol-1-yl)oct-6-en-3-ol (PubChem CID 46179311) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is (E,3R,4R)-8-(2,3-dichlorophenoxy)-2,2,6,7-tetramethyl-4-(1,2,4-triazol-1-yl)oct-6-en-3-ol.
| Compound Name | (E,3R,4R)-8-(2,3-dichlorophenoxy)-2,2,6,7-tetramethyl-4-(1,2,4-triazol-1-yl)oct-6-en-3-ol |
|---|---|
| PubChem CID | 46179311 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (E,3R,4R)-8-(2,3-dichlorophenoxy)-2,2,6,7-tetramethyl-4-(1,2,4-triazol-1-yl)oct-6-en-3-ol |
| SMILES | C/C(COc1cccc(Cl)c1Cl)=C(/C)C[C@H]([C@H](O)C(C)(C)C)n1cncn1 |
| InChI | InChI=1S/C20H27Cl2N3O2/c1-13(14(2)10-27-17-8-6-7-15(21)18(17)22)9-16(19(26)20(3,4)5)25-12-23-11-24-25/h6-8,11-12,16,19,26H,9-10H2,1-5H3/b14-13+/t16-,19+/m1/s1 |
| InChIKey | MMUGIHWYVGPNTD-BXWWLFJKSA-N |
| XLogP | 5.34 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|