C21H23ClN4O2S — CID 46179326
2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 46179326) has the molecular formula C21H23ClN4O2S and a molecular weight of 430.96 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 46179326 |
| Molecular Formula | C21H23ClN4O2S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[1-(2-chlorophenyl)sulfonylpyrrolo[3,2-b]pyridin-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1ccccc1Cl)n1cc(N2CCN3CCCCC3C2)c2ncccc21 |
| InChI | InChI=1S/C21H23ClN4O2S/c22-17-7-1-2-9-20(17)29(27,28)26-15-19(21-18(26)8-5-10-23-21)25-13-12-24-11-4-3-6-16(24)14-25/h1-2,5,7-10,15-16H,3-4,6,11-14H2 |
| InChIKey | QXWKNWCYTDWNLM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |