C10H5Cl2N3O2S — CID 46179703
2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]benzoic acid (PubChem CID 46179703) has the molecular formula C10H5Cl2N3O2S and a molecular weight of 302.14 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]benzoic acid.
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 46179703 |
| Molecular Formula | C10H5Cl2N3O2S |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)sulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1Sc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H5Cl2N3O2S/c11-8-13-9(12)15-10(14-8)18-6-4-2-1-3-5(6)7(16)17/h1-4H,(H,16,17) |
| InChIKey | GJJICHFPKUIQAZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |