About N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide
N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide (PubChem CID 46179732) has the molecular formula C22H31N5O3
and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
| PubChem CID | 46179732 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1cccc(-c2cn(C3CCCCC3)nn2)c1)NO |
| InChI | InChI=1S/C22H31N5O3/c28-21(13-6-1-2-7-14-22(29)25-30)23-18-10-8-9-17(15-18)20-16-27(26-24-20)19-11-4-3-5-12-19/h8-10,15-16,19,30H,1-7,11-14H2,(H,23,28)(H,25,29) |
| InChIKey | XPQULOSXGAVNNQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The IUPAC name of N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide (CID 46179732) is N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide.
What is the SMILES notation for N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The canonical SMILES for N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide is O=C(CCCCCCC(=O)Nc1cccc(-c2cn(C3CCCCC3)nn2)c1)NO.
What is the InChIKey of N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
The InChIKey is XPQULOSXGAVNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N5O3/c28-21(13-6-1-2-7-14-22(29)25-30)23-18-10-8-9-17(15-18)20-16-27(26-24-20)19-11-4-3-5-12-19/h8-10,15-16,19,30H,1-7,11-14H2,(H,23,28)(H,25,29).
What are the key properties of N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide?
N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide has a molecular weight of 413.52 g/mol, XLogP of 4.23, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1-cyclohexyltriazol-4-yl)phenyl]-N'-hydroxyoctanediamide is sourced from PubChem (CID 46179732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).