C16H9F17N2O3S — CID 4617978
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[(4-sulfamoylphenyl)methyl]nonanamide (PubChem CID 4617978) has the molecular formula C16H9F17N2O3S and a molecular weight of 632.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[(4-sulfamoylphenyl)methyl]nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[(4-sulfamoylphenyl)methyl]nonanamide |
|---|---|
| PubChem CID | 4617978 |
| Molecular Formula | C16H9F17N2O3S |
| Molecular Weight | 632.29 g/mol |
| Exact Mass | 632.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-[(4-sulfamoylphenyl)methyl]nonanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H9F17N2O3S/c17-9(18,8(36)35-5-6-1-3-7(4-2-6)39(34,37)38)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-4H,5H2,(H,35,36)(H2,34,37,38) |
| InChIKey | JHVJTHXQPPKMEA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|