C22H26N2O3 — CID 46180132
N-[(1R,5S)-2,4-bis(2-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine (PubChem CID 46180132) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(1R,5S)-2,4-bis(2-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine.
| Compound Name | N-[(1R,5S)-2,4-bis(2-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 46180132 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(1R,5S)-2,4-bis(2-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
| SMILES | COc1ccccc1C1NC(c2ccccc2OC)[C@H]2CCC[C@@H]1/C2=N/O |
| InChI | InChI=1S/C22H26N2O3/c1-26-18-12-5-3-8-14(18)20-16-10-7-11-17(22(16)24-25)21(23-20)15-9-4-6-13-19(15)27-2/h3-6,8-9,12-13,16-17,20-21,23,25H,7,10-11H2,1-2H3/b24-22-/t16-,17+,20?,21?/m0/s1 |
| InChIKey | FTJDRMCWCBCLIZ-NARRCWORSA-N |
| XLogP | 4.34 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|