C20H36O3Si — CID 46180223
[(3S,4S,5E)-8-[tert-butyl(dimethyl)silyl]oxy-3,6-dimethylocta-1,5-dien-4-yl] 2-methylprop-2-enoate (PubChem CID 46180223) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is [(3S,4S,5E)-8-[tert-butyl(dimethyl)silyl]oxy-3,6-dimethylocta-1,5-dien-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(3S,4S,5E)-8-[tert-butyl(dimethyl)silyl]oxy-3,6-dimethylocta-1,5-dien-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 46180223 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | [(3S,4S,5E)-8-[tert-butyl(dimethyl)silyl]oxy-3,6-dimethylocta-1,5-dien-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C[C@H](C)[C@@H](/C=C(\C)CCO[Si](C)(C)C(C)(C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C20H36O3Si/c1-11-17(5)18(23-19(21)15(2)3)14-16(4)12-13-22-24(9,10)20(6,7)8/h11,14,17-18H,1-2,12-13H2,3-10H3/b16-14+/t17-,18+/m0/s1 |
| InChIKey | RRFQWIYPAGXWIR-QUSVSHMOSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|