C17H26F2O4 — CID 46180274
(2S)-3,3-difluoro-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-2H-pyran-6-one (PubChem CID 46180274) has the molecular formula C17H26F2O4 and a molecular weight of 332.39 g/mol. Its IUPAC name is (2S)-3,3-difluoro-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-2H-pyran-6-one.
| Compound Name | (2S)-3,3-difluoro-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-2H-pyran-6-one |
|---|---|
| PubChem CID | 46180274 |
| Molecular Formula | C17H26F2O4 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2S)-3,3-difluoro-2-[(E,2R,3S,4R,5S)-2-hydroxy-4-methoxy-3,5-dimethylnon-7-enyl]-2H-pyran-6-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@H](O)C[C@@H]1OC(=O)C=CC1(F)F |
| InChI | InChI=1S/C17H26F2O4/c1-5-6-7-11(2)16(22-4)12(3)13(20)10-14-17(18,19)9-8-15(21)23-14/h5-6,8-9,11-14,16,20H,7,10H2,1-4H3/b6-5+/t11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | QXUAHMMXXFBABJ-SJIBOVSCSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|