C24H26N2O6 — CID 46180730
(4-nitrophenyl) N-[3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl]carbamate (PubChem CID 46180730) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is (4-nitrophenyl) N-[3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl]carbamate |
|---|---|
| PubChem CID | 46180730 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (4-nitrophenyl) N-[3-[(5'R)-5'-hydroxy-2',5',7'-trimethyl-4'-oxospiro[cyclopropane-1,6'-indene]-1'-yl]propyl]carbamate |
| SMILES | CC1=C(CCCNC(=O)Oc2ccc([N+](=O)[O-])cc2)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1 |
| InChI | InChI=1S/C24H26N2O6/c1-14-13-19-20(15(2)24(10-11-24)23(3,29)21(19)27)18(14)5-4-12-25-22(28)32-17-8-6-16(7-9-17)26(30)31/h6-9,13,29H,4-5,10-12H2,1-3H3,(H,25,28)/t23-/m0/s1 |
| InChIKey | ZNMWMBYHLZXGKB-QHCPKHFHSA-N |
| XLogP | 4.15 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|