C17H18O6S — CID 46180764
5-hydroxy-8-(methylsulfinylmethyl)-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione (PubChem CID 46180764) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is 5-hydroxy-8-(methylsulfinylmethyl)-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione.
| Compound Name | 5-hydroxy-8-(methylsulfinylmethyl)-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
|---|---|
| PubChem CID | 46180764 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-hydroxy-8-(methylsulfinylmethyl)-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
| SMILES | CCCc1cc(=O)oc2c3c(cc(O)c12)OC(CS(C)=O)CC3=O |
| InChI | InChI=1S/C17H18O6S/c1-3-4-9-5-14(20)23-17-15(9)12(19)7-13-16(17)11(18)6-10(22-13)8-24(2)21/h5,7,10,19H,3-4,6,8H2,1-2H3 |
| InChIKey | DOISACFEHZDOGL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|