C21H18F3NO4 — CID 46180877
3-[1-[4-hydroxy-2-(trifluoromethyl)phenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 46180877) has the molecular formula C21H18F3NO4 and a molecular weight of 405.37 g/mol. Its IUPAC name is 3-[1-[4-hydroxy-2-(trifluoromethyl)phenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-[4-hydroxy-2-(trifluoromethyl)phenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 46180877 |
| Molecular Formula | C21H18F3NO4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-[1-[4-hydroxy-2-(trifluoromethyl)phenyl]-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(=O)O)n2-c2ccc(O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F3NO4/c1-29-16-7-2-13(3-8-16)18-9-4-14(5-11-20(27)28)25(18)19-10-6-15(26)12-17(19)21(22,23)24/h2-4,6-10,12,26H,5,11H2,1H3,(H,27,28) |
| InChIKey | YCSLQIJIFFXLNO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|