C16H9F3N4OS — CID 46181500
1-(3H-benzimidazol-5-yl)-4-sulfanylidene-5-(2,3,4-trifluorophenyl)imidazolidin-2-one (PubChem CID 46181500) has the molecular formula C16H9F3N4OS and a molecular weight of 362.34 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-sulfanylidene-5-(2,3,4-trifluorophenyl)imidazolidin-2-one.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-sulfanylidene-5-(2,3,4-trifluorophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 46181500 |
| Molecular Formula | C16H9F3N4OS |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-sulfanylidene-5-(2,3,4-trifluorophenyl)imidazolidin-2-one |
| SMILES | O=C1NC(=S)C(c2ccc(F)c(F)c2F)N1c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H9F3N4OS/c17-9-3-2-8(12(18)13(9)19)14-15(25)22-16(24)23(14)7-1-4-10-11(5-7)21-6-20-10/h1-6,14H,(H,20,21)(H,22,24,25) |
| InChIKey | NGJZDGZTGWZQHU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|