C30H45NO7S — CID 46181802
[(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2R,5S)-5-formamido-2-formyloxycyclohexyl]sulfanylacetate (PubChem CID 46181802) has the molecular formula C30H45NO7S and a molecular weight of 563.76 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2R,5S)-5-formamido-2-formyloxycyclohexyl]sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2R,5S)-5-formamido-2-formyloxycyclohexyl]sulfanylacetate |
|---|---|
| PubChem CID | 46181802 |
| Molecular Formula | C30H45NO7S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | [(2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(1R,2R,5S)-5-formamido-2-formyloxycyclohexyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@@H]2C[C@@H](NC=O)CC[C@H]2OC=O)[C@]2(C)C(C)CCC3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H45NO7S/c1-6-28(4)14-24(38-25(35)15-39-23-13-20(31-16-32)7-8-22(23)37-17-33)29(5)18(2)9-11-30(19(3)27(28)36)12-10-21(34)26(29)30/h6,16-20,22-24,26-27,36H,1,7-15H2,2-5H3,(H,31,32)/t18?,19-,20-,22+,23+,24+,26-,27-,28+,29-,30?/m0/s1 |
| InChIKey | LHRSZQWILIMUFZ-GWPNQOGUSA-N |
| XLogP | 3.83 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|