About 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one
5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one (PubChem CID 46183077) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one.
Molecular Properties
| Compound Name | 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one |
| PubChem CID | 46183077 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one |
| SMILES | C=C(C)C(CCC(C)=O)N(O)c1cc(C)on1 |
| InChI | InChI=1S/C12H18N2O3/c1-8(2)11(6-5-9(3)15)14(16)12-7-10(4)17-13-12/h7,11,16H,1,5-6H2,2-4H3 |
| InChIKey | LHXROWCNOXQUAV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one?
The IUPAC name of 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one (CID 46183077) is 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one.
What is the SMILES notation for 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one?
The canonical SMILES for 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one is C=C(C)C(CCC(C)=O)N(O)c1cc(C)on1.
What is the InChIKey of 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one?
The InChIKey is LHXROWCNOXQUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-8(2)11(6-5-9(3)15)14(16)12-7-10(4)17-13-12/h7,11,16H,1,5-6H2,2-4H3.
What are the key properties of 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one?
5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one has a molecular weight of 238.29 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[hydroxy-(5-methyl-1,2-oxazol-3-yl)amino]-6-methylhept-6-en-2-one is sourced from PubChem (CID 46183077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).