About 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one
1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one (PubChem CID 46183170) has the molecular formula C24H30BrNO
and a molecular weight of 428.41 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one |
| PubChem CID | 46183170 |
| Molecular Formula | C24H30BrNO |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC(C3)CC2C4)C1C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C24H30BrNO/c1-23(2)21(24(7-8-24)18-3-5-19(25)6-4-18)26(22(23)27)20-16-10-14-9-15(12-16)13-17(20)11-14/h3-6,14-17,20-21H,7-13H2,1-2H3 |
| InChIKey | SJWKVQYQKSAWPZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one?
The IUPAC name of 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one (CID 46183170) is 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one?
The canonical SMILES for 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one is CC1(C)C(=O)N(C2C3CC4CC(C3)CC2C4)C1C1(c2ccc(Br)cc2)CC1.
What is the InChIKey of 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one?
The InChIKey is SJWKVQYQKSAWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30BrNO/c1-23(2)21(24(7-8-24)18-3-5-19(25)6-4-18)26(22(23)27)20-16-10-14-9-15(12-16)13-17(20)11-14/h3-6,14-17,20-21H,7-13H2,1-2H3.
What are the key properties of 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one?
1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one has a molecular weight of 428.41 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-adamantyl)-4-[1-(4-bromophenyl)cyclopropyl]-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 46183170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).