C31H39FN4OS — CID 46183218
N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)benzamide (PubChem CID 46183218) has the molecular formula C31H39FN4OS and a molecular weight of 534.75 g/mol. Its IUPAC name is N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)benzamide.
| Compound Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 46183218 |
| Molecular Formula | C31H39FN4OS |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | N-[4-[2-[[(6S)-2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]-propylamino]ethyl]cyclohexyl]-4-(3-fluorophenyl)benzamide |
| SMILES | CCCN(CCC1CCC(NC(=O)c2ccc(-c3cccc(F)c3)cc2)CC1)[C@H]1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C31H39FN4OS/c1-2-17-36(27-14-15-28-29(20-27)38-31(33)35-28)18-16-21-6-12-26(13-7-21)34-30(37)23-10-8-22(9-11-23)24-4-3-5-25(32)19-24/h3-5,8-11,19,21,26-27H,2,6-7,12-18,20H2,1H3,(H2,33,35)(H,34,37)/t21?,26?,27-/m0/s1 |
| InChIKey | GUHPZYGLECMYHS-OFHXQBPLSA-N |
| XLogP | 6.48 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |