C15H20FN6O12P3 — CID 46183272
[[(2R,3R,4R,5R)-5-[4-amino-5-(1H-pyrazol-5-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 46183272) has the molecular formula C15H20FN6O12P3 and a molecular weight of 588.28 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-[4-amino-5-(1H-pyrazol-5-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-[4-amino-5-(1H-pyrazol-5-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 46183272 |
| Molecular Formula | C15H20FN6O12P3 |
| Molecular Weight | 588.28 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-[4-amino-5-(1H-pyrazol-5-yl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc(-c2ccn[nH]2)c2c(N)ncnc21 |
| InChI | InChI=1S/C15H20FN6O12P3/c1-15(16)11(23)9(5-31-36(27,28)34-37(29,30)33-35(24,25)26)32-14(15)22-4-7(8-2-3-20-21-8)10-12(17)18-6-19-13(10)22/h2-4,6,9,11,14,23H,5H2,1H3,(H,20,21)(H,27,28)(H,29,30)(H2,17,18,19)(H2,24,25,26)/t9-,11-,14-,15-/m1/s1 |
| InChIKey | GBBBLCXMUJZZNH-NZQZLILVSA-N |
| XLogP | 0.73 |
| TPSA | 274.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|