C20H23N7O — CID 46183283
cis-(1R,3S)-3-[[[2-[(3-methyl-2H-indazol-6-yl)amino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]amino]methyl]cyclopentan-1-ol (PubChem CID 46183283) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[[2-[(3-methyl-2H-indazol-6-yl)amino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]amino]methyl]cyclopentan-1-ol.
| Compound Name | cis-(1R,3S)-3-[[[2-[(3-methyl-2H-indazol-6-yl)amino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 46183283 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | cis-(1R,3S)-3-[[[2-[(3-methyl-2H-indazol-6-yl)amino]-[1,2,4]triazolo[1,5-a]pyridin-5-yl]amino]methyl]cyclopentan-1-ol |
| SMILES | Cc1[nH]nc2cc(Nc3nc4cccc(NC[C@H]5CC[C@@H](O)C5)n4n3)ccc12 |
| InChI | InChI=1S/C20H23N7O/c1-12-16-8-6-14(10-17(16)25-24-12)22-20-23-19-4-2-3-18(27(19)26-20)21-11-13-5-7-15(28)9-13/h2-4,6,8,10,13,15,21,28H,5,7,9,11H2,1H3,(H,22,26)(H,24,25)/t13-,15+/m0/s1 |
| InChIKey | LFVCYUPSMWYSRK-DZGCQCFKSA-N |
| XLogP | 3.23 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |