C9H13NO6S — CID 46183393
[(3R,3aS,6S,6aS)-6-prop-2-enylsulfinyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 46183393) has the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-prop-2-enylsulfinyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [(3R,3aS,6S,6aS)-6-prop-2-enylsulfinyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 46183393 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-prop-2-enylsulfinyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | C=CCS(=O)[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO6S/c1-2-3-17(13)7-5-15-8-6(16-10(11)12)4-14-9(7)8/h2,6-9H,1,3-5H2/t6-,7+,8-,9-,17?/m1/s1 |
| InChIKey | WIWXUANSBWFBJL-HAXFSZLHSA-N |
| XLogP | -0.34 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|