About [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 4618368) has the molecular formula C15H13Cl2N3O3
and a molecular weight of 354.19 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| PubChem CID | 4618368 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnccn1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O3/c16-11-2-1-10(12(17)7-11)3-4-20-14(21)9-23-15(22)13-8-18-5-6-19-13/h1-2,5-8H,3-4,9H2,(H,20,21) |
| InChIKey | PVAWJJNNKNXOSM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate (CID 4618368) is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate.
What is the SMILES notation for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The canonical SMILES for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate is O=C(COC(=O)c1cnccn1)NCCc1ccc(Cl)cc1Cl.
What is the InChIKey of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate?
The InChIKey is PVAWJJNNKNXOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O3/c16-11-2-1-10(12(17)7-11)3-4-20-14(21)9-23-15(22)13-8-18-5-6-19-13/h1-2,5-8H,3-4,9H2,(H,20,21).
What are the key properties of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate?
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate has a molecular weight of 354.19 g/mol, XLogP of 2.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate is sourced from PubChem (CID 4618368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).