About 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole
9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole (PubChem CID 46183928) has the molecular formula C25H19ClN2O2S
and a molecular weight of 446.96 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole |
| PubChem CID | 46183928 |
| Molecular Formula | C25H19ClN2O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole |
| SMILES | O=S(=O)(c1ccccc1)n1c2ccc(CCc3ccccc3)cc2c2cc(Cl)cnc21 |
| InChI | InChI=1S/C25H19ClN2O2S/c26-20-16-23-22-15-19(12-11-18-7-3-1-4-8-18)13-14-24(22)28(25(23)27-17-20)31(29,30)21-9-5-2-6-10-21/h1-10,13-17H,11-12H2 |
| InChIKey | YIPYYUXDHHEITL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole (CID 46183928) is 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole is O=S(=O)(c1ccccc1)n1c2ccc(CCc3ccccc3)cc2c2cc(Cl)cnc21.
What is the InChIKey of 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole?
The InChIKey is YIPYYUXDHHEITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN2O2S/c26-20-16-23-22-15-19(12-11-18-7-3-1-4-8-18)13-14-24(22)28(25(23)27-17-20)31(29,30)21-9-5-2-6-10-21/h1-10,13-17H,11-12H2.
What are the key properties of 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole?
9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole has a molecular weight of 446.96 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-3-chloro-6-(2-phenylethyl)pyrido[2,3-b]indole is sourced from PubChem (CID 46183928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).