C23H24F3NO5S — CID 46184235
ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate (PubChem CID 46184235) has the molecular formula C23H24F3NO5S and a molecular weight of 483.51 g/mol. Its IUPAC name is ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 46184235 |
| Molecular Formula | C23H24F3NO5S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc(C(F)(F)F)cc2)[C@H]1C=O |
| InChI | InChI=1S/C23H24F3NO5S/c1-3-32-21(29)12-17-13-27(33(30,31)19-10-4-15(2)5-11-19)22(20(17)14-28)16-6-8-18(9-7-16)23(24,25)26/h4-11,14,17,20,22H,3,12-13H2,1-2H3/t17-,20+,22-/m1/s1 |
| InChIKey | NPRDBGRERWXZDY-PIPMEXSNSA-N |
| XLogP | 4.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|