C22H24N2O7S — CID 46184236
ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)pyrrolidin-3-yl]acetate (PubChem CID 46184236) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)pyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 46184236 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethyl 2-[(3S,4S,5S)-4-formyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)pyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccc([N+](=O)[O-])cc2)[C@H]1C=O |
| InChI | InChI=1S/C22H24N2O7S/c1-3-31-21(26)12-17-13-23(32(29,30)19-10-4-15(2)5-11-19)22(20(17)14-25)16-6-8-18(9-7-16)24(27)28/h4-11,14,17,20,22H,3,12-13H2,1-2H3/t17-,20+,22-/m1/s1 |
| InChIKey | LSUFBGJARWPKOB-PIPMEXSNSA-N |
| XLogP | 3.03 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|